C23H19F3O4 — CID 59820289
2-[3-ethoxy-5-[3-[2-(trifluoromethyl)phenyl]phenoxy]phenyl]acetic acid (PubChem CID 59820289) has the molecular formula C23H19F3O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-[3-ethoxy-5-[3-[2-(trifluoromethyl)phenyl]phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-ethoxy-5-[3-[2-(trifluoromethyl)phenyl]phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 59820289 |
| Molecular Formula | C23H19F3O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[3-ethoxy-5-[3-[2-(trifluoromethyl)phenyl]phenoxy]phenyl]acetic acid |
| SMILES | CCOc1cc(CC(=O)O)cc(Oc2cccc(-c3ccccc3C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H19F3O4/c1-2-29-18-10-15(12-22(27)28)11-19(14-18)30-17-7-5-6-16(13-17)20-8-3-4-9-21(20)23(24,25)26/h3-11,13-14H,2,12H2,1H3,(H,27,28) |
| InChIKey | RERJWFJWZACTHO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |