C20H24N2O4 — CID 71213055
2-[3-[3-[(Z)-3-amino-1-(methylamino)prop-1-en-2-yl]phenoxy]-5-ethoxyphenyl]acetic acid (PubChem CID 71213055) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[3-[3-[(Z)-3-amino-1-(methylamino)prop-1-en-2-yl]phenoxy]-5-ethoxyphenyl]acetic acid.
| Compound Name | 2-[3-[3-[(Z)-3-amino-1-(methylamino)prop-1-en-2-yl]phenoxy]-5-ethoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 71213055 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[3-[3-[(Z)-3-amino-1-(methylamino)prop-1-en-2-yl]phenoxy]-5-ethoxyphenyl]acetic acid |
| SMILES | CCOc1cc(CC(=O)O)cc(Oc2cccc(/C(=C/NC)CN)c2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-3-25-18-7-14(9-20(23)24)8-19(11-18)26-17-6-4-5-15(10-17)16(12-21)13-22-2/h4-8,10-11,13,22H,3,9,12,21H2,1-2H3,(H,23,24)/b16-13+ |
| InChIKey | HCONUFUZBNIZAC-DTQAZKPQSA-N |
| XLogP | 3.02 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |