C26H27NO6 — CID 90709110
2-[3-[2-(methoxyamino)-2-(3-phenoxyphenyl)ethenoxy]-5-propan-2-yloxyphenyl]acetic acid (PubChem CID 90709110) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is 2-[3-[2-(methoxyamino)-2-(3-phenoxyphenyl)ethenoxy]-5-propan-2-yloxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-(methoxyamino)-2-(3-phenoxyphenyl)ethenoxy]-5-propan-2-yloxyphenyl]acetic acid |
|---|---|
| PubChem CID | 90709110 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-[3-[2-(methoxyamino)-2-(3-phenoxyphenyl)ethenoxy]-5-propan-2-yloxyphenyl]acetic acid |
| SMILES | CONC(=COc1cc(CC(=O)O)cc(OC(C)C)c1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H27NO6/c1-18(2)32-24-13-19(14-26(28)29)12-23(16-24)31-17-25(27-30-3)20-8-7-11-22(15-20)33-21-9-5-4-6-10-21/h4-13,15-18,27H,14H2,1-3H3,(H,28,29) |
| InChIKey | NHJHNBYSIWKRQB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|