C19H22O3 — CID 67418850
[3,5-di(propan-2-yloxy)phenyl]-phenylmethanone (PubChem CID 67418850) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is [3,5-di(propan-2-yloxy)phenyl]-phenylmethanone.
| Compound Name | [3,5-di(propan-2-yloxy)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 67418850 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [3,5-di(propan-2-yloxy)phenyl]-phenylmethanone |
| SMILES | CC(C)Oc1cc(OC(C)C)cc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H22O3/c1-13(2)21-17-10-16(11-18(12-17)22-14(3)4)19(20)15-8-6-5-7-9-15/h5-14H,1-4H3 |
| InChIKey | JEEZDNJHGFKEKP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |