C28H30NNaO6 — CID 142688168
sodium 2-[3-[(2Z)-2-(3-phenoxyphenyl)-2-propoxyiminoethoxy]-5-propan-2-yloxyphenyl]acetate (PubChem CID 142688168) has the molecular formula C28H30NNaO6 and a molecular weight of 499.54 g/mol. Its IUPAC name is sodium 2-[3-[(2Z)-2-(3-phenoxyphenyl)-2-propoxyiminoethoxy]-5-propan-2-yloxyphenyl]acetate.
| Compound Name | sodium 2-[3-[(2Z)-2-(3-phenoxyphenyl)-2-propoxyiminoethoxy]-5-propan-2-yloxyphenyl]acetate |
|---|---|
| PubChem CID | 142688168 |
| Molecular Formula | C28H30NNaO6 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | sodium 2-[3-[(2Z)-2-(3-phenoxyphenyl)-2-propoxyiminoethoxy]-5-propan-2-yloxyphenyl]acetate |
| SMILES | CCCO/N=C(\COc1cc(CC(=O)[O-])cc(OC(C)C)c1)c1cccc(Oc2ccccc2)c1.[Na+] |
| InChI | InChI=1S/C28H31NO6.Na/c1-4-13-33-29-27(22-9-8-12-24(17-22)35-23-10-6-5-7-11-23)19-32-25-14-21(16-28(30)31)15-26(18-25)34-20(2)3;/h5-12,14-15,17-18,20H,4,13,16,19H2,1-3H3,(H,30,31);/q;+1/p-1/b29-27+; |
| InChIKey | AZUFPMVGOXHGCY-HEKQOYCRSA-M |
| XLogP | 1.77 |
| TPSA | 89.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|