C24H27N2NaO6S — CID 142688179
sodium 2-[1-[(2Z)-2-propoxyimino-2-(3-propylsulfonyloxyphenyl)ethyl]indol-3-yl]acetate (PubChem CID 142688179) has the molecular formula C24H27N2NaO6S and a molecular weight of 494.55 g/mol. Its IUPAC name is sodium 2-[1-[(2Z)-2-propoxyimino-2-(3-propylsulfonyloxyphenyl)ethyl]indol-3-yl]acetate.
| Compound Name | sodium 2-[1-[(2Z)-2-propoxyimino-2-(3-propylsulfonyloxyphenyl)ethyl]indol-3-yl]acetate |
|---|---|
| PubChem CID | 142688179 |
| Molecular Formula | C24H27N2NaO6S |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | sodium 2-[1-[(2Z)-2-propoxyimino-2-(3-propylsulfonyloxyphenyl)ethyl]indol-3-yl]acetate |
| SMILES | CCCO/N=C(\Cn1cc(CC(=O)[O-])c2ccccc21)c1cccc(OS(=O)(=O)CCC)c1.[Na+] |
| InChI | InChI=1S/C24H28N2O6S.Na/c1-3-12-31-25-22(18-8-7-9-20(14-18)32-33(29,30)13-4-2)17-26-16-19(15-24(27)28)21-10-5-6-11-23(21)26;/h5-11,14,16H,3-4,12-13,15,17H2,1-2H3,(H,27,28);/q;+1/p-1/b25-22+; |
| InChIKey | QAYGNYHHPZFJIQ-OSMRDGEFSA-M |
| XLogP | -0.11 |
| TPSA | 110.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|