C26H20N2O4S — CID 45029403
(E)-2-(benzenesulfonyl)-3-[1-[2-(3-methoxyphenyl)-2-oxoethyl]indol-3-yl]prop-2-enenitrile (PubChem CID 45029403) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-[1-[2-(3-methoxyphenyl)-2-oxoethyl]indol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-[1-[2-(3-methoxyphenyl)-2-oxoethyl]indol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 45029403 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-[1-[2-(3-methoxyphenyl)-2-oxoethyl]indol-3-yl]prop-2-enenitrile |
| SMILES | COc1cccc(C(=O)Cn2cc(/C=C(\C#N)S(=O)(=O)c3ccccc3)c3ccccc32)c1 |
| InChI | InChI=1S/C26H20N2O4S/c1-32-21-9-7-8-19(14-21)26(29)18-28-17-20(24-12-5-6-13-25(24)28)15-23(16-27)33(30,31)22-10-3-2-4-11-22/h2-15,17H,18H2,1H3/b23-15+ |
| InChIKey | ULSFUXKWUCYBQA-HZHRSRAPSA-N |
| XLogP | 4.87 |
| TPSA | 89.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|