C24H16Cl2N2O2S — CID 17349261
(E)-3-[1-[(3-chlorophenyl)methyl]indol-3-yl]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile (PubChem CID 17349261) has the molecular formula C24H16Cl2N2O2S and a molecular weight of 467.38 g/mol. Its IUPAC name is (E)-3-[1-[(3-chlorophenyl)methyl]indol-3-yl]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile.
| Compound Name | (E)-3-[1-[(3-chlorophenyl)methyl]indol-3-yl]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 17349261 |
| Molecular Formula | C24H16Cl2N2O2S |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | (E)-3-[1-[(3-chlorophenyl)methyl]indol-3-yl]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn(Cc2cccc(Cl)c2)c2ccccc12)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H16Cl2N2O2S/c25-19-8-10-21(11-9-19)31(29,30)22(14-27)13-18-16-28(24-7-2-1-6-23(18)24)15-17-4-3-5-20(26)12-17/h1-13,16H,15H2/b22-13+ |
| InChIKey | GYDLFUPFVJUMPU-LPYMAVHISA-N |
| XLogP | 6.33 |
| TPSA | 62.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|