C27H22FN2NaO4 — CID 142695222
sodium 4-[(4-fluorophenyl)methyl]-1-[(2Z)-2-methoxyimino-2-(3-phenoxyphenyl)ethyl]pyrrole-3-carboxylate (PubChem CID 142695222) has the molecular formula C27H22FN2NaO4 and a molecular weight of 480.47 g/mol. Its IUPAC name is sodium 4-[(4-fluorophenyl)methyl]-1-[(2Z)-2-methoxyimino-2-(3-phenoxyphenyl)ethyl]pyrrole-3-carboxylate.
| Compound Name | sodium 4-[(4-fluorophenyl)methyl]-1-[(2Z)-2-methoxyimino-2-(3-phenoxyphenyl)ethyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 142695222 |
| Molecular Formula | C27H22FN2NaO4 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | sodium 4-[(4-fluorophenyl)methyl]-1-[(2Z)-2-methoxyimino-2-(3-phenoxyphenyl)ethyl]pyrrole-3-carboxylate |
| SMILES | CO/N=C(\Cn1cc(Cc2ccc(F)cc2)c(C(=O)[O-])c1)c1cccc(Oc2ccccc2)c1.[Na+] |
| InChI | InChI=1S/C27H23FN2O4.Na/c1-33-29-26(20-6-5-9-24(15-20)34-23-7-3-2-4-8-23)18-30-16-21(25(17-30)27(31)32)14-19-10-12-22(28)13-11-19;/h2-13,15-17H,14,18H2,1H3,(H,31,32);/q;+1/p-1/b29-26+; |
| InChIKey | BDQKPIWDECWTFU-XWNIEBHWSA-M |
| XLogP | 1.43 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|