About [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate
[3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate (PubChem CID 143339875) has the molecular formula C21H17FO4
and a molecular weight of 352.36 g/mol. Its IUPAC name is [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate.
Molecular Properties
| Compound Name | [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate |
| PubChem CID | 143339875 |
| Molecular Formula | C21H17FO4 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate |
| SMILES | COc1ccc(OOC(=O)c2ccccc2)cc1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FO4/c1-24-20-12-11-19(25-26-21(23)16-5-3-2-4-6-16)14-17(20)13-15-7-9-18(22)10-8-15/h2-12,14H,13H2,1H3 |
| InChIKey | VHOXMRCVLBAJEF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate?
The IUPAC name of [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate (CID 143339875) is [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate.
What is the SMILES notation for [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate?
The canonical SMILES for [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate is COc1ccc(OOC(=O)c2ccccc2)cc1Cc1ccc(F)cc1.
What is the InChIKey of [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate?
The InChIKey is VHOXMRCVLBAJEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17FO4/c1-24-20-12-11-19(25-26-21(23)16-5-3-2-4-6-16)14-17(20)13-15-7-9-18(22)10-8-15/h2-12,14H,13H2,1H3.
What are the key properties of [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate?
[3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate has a molecular weight of 352.36 g/mol, XLogP of 4.58, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-fluorophenyl)methyl]-4-methoxyphenyl] benzenecarboperoxoate is sourced from PubChem (CID 143339875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).