C27H24FN3O4 — CID 142695180
1-[(2Z)-2-ethoxyimino-2-(3-pyridin-2-yloxyphenyl)ethyl]-4-[(4-fluorophenyl)methyl]pyrrole-3-carboxylic acid (PubChem CID 142695180) has the molecular formula C27H24FN3O4 and a molecular weight of 473.50 g/mol. Its IUPAC name is 1-[(2Z)-2-ethoxyimino-2-(3-pyridin-2-yloxyphenyl)ethyl]-4-[(4-fluorophenyl)methyl]pyrrole-3-carboxylic acid.
| Compound Name | 1-[(2Z)-2-ethoxyimino-2-(3-pyridin-2-yloxyphenyl)ethyl]-4-[(4-fluorophenyl)methyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 142695180 |
| Molecular Formula | C27H24FN3O4 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 1-[(2Z)-2-ethoxyimino-2-(3-pyridin-2-yloxyphenyl)ethyl]-4-[(4-fluorophenyl)methyl]pyrrole-3-carboxylic acid |
| SMILES | CCO/N=C(\Cn1cc(Cc2ccc(F)cc2)c(C(=O)O)c1)c1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C27H24FN3O4/c1-2-34-30-25(20-6-5-7-23(15-20)35-26-8-3-4-13-29-26)18-31-16-21(24(17-31)27(32)33)14-19-9-11-22(28)12-10-19/h3-13,15-17H,2,14,18H2,1H3,(H,32,33)/b30-25+ |
| InChIKey | CDCCDCDXGXXIDH-QCWLDUFUSA-N |
| XLogP | 5.54 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|