C20H20N2O2 — CID 121187049
(4-cyclopropylidenepiperidin-1-yl)-(3-pyridin-2-yloxyphenyl)methanone (PubChem CID 121187049) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (4-cyclopropylidenepiperidin-1-yl)-(3-pyridin-2-yloxyphenyl)methanone.
| Compound Name | (4-cyclopropylidenepiperidin-1-yl)-(3-pyridin-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 121187049 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (4-cyclopropylidenepiperidin-1-yl)-(3-pyridin-2-yloxyphenyl)methanone |
| SMILES | O=C(c1cccc(Oc2ccccn2)c1)N1CCC(=C2CC2)CC1 |
| InChI | InChI=1S/C20H20N2O2/c23-20(22-12-9-16(10-13-22)15-7-8-15)17-4-3-5-18(14-17)24-19-6-1-2-11-21-19/h1-6,11,14H,7-10,12-13H2 |
| InChIKey | NNLMTKBZNMIAAC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|