C15H18Cl2N4O2 — CID 119482802
(3-aminopyrrolidin-1-yl)-(3-pyrazin-2-yloxyphenyl)methanone;dihydrochloride (PubChem CID 119482802) has the molecular formula C15H18Cl2N4O2 and a molecular weight of 357.24 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(3-pyrazin-2-yloxyphenyl)methanone;dihydrochloride.
| Compound Name | (3-aminopyrrolidin-1-yl)-(3-pyrazin-2-yloxyphenyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119482802 |
| Molecular Formula | C15H18Cl2N4O2 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(3-pyrazin-2-yloxyphenyl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(C(=O)c2cccc(Oc3cnccn3)c2)C1 |
| InChI | InChI=1S/C15H16N4O2.2ClH/c16-12-4-7-19(10-12)15(20)11-2-1-3-13(8-11)21-14-9-17-5-6-18-14;;/h1-3,5-6,8-9,12H,4,7,10,16H2;2*1H |
| InChIKey | FWWQWANXYQJIGW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |