C18H16N6O2 — CID 166340156
[3-(2-aminopyrimidin-4-yl)azetidin-1-yl]-(3-pyrazin-2-yloxyphenyl)methanone (PubChem CID 166340156) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is [3-(2-aminopyrimidin-4-yl)azetidin-1-yl]-(3-pyrazin-2-yloxyphenyl)methanone.
| Compound Name | [3-(2-aminopyrimidin-4-yl)azetidin-1-yl]-(3-pyrazin-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 166340156 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [3-(2-aminopyrimidin-4-yl)azetidin-1-yl]-(3-pyrazin-2-yloxyphenyl)methanone |
| SMILES | Nc1nccc(C2CN(C(=O)c3cccc(Oc4cnccn4)c3)C2)n1 |
| InChI | InChI=1S/C18H16N6O2/c19-18-22-5-4-15(23-18)13-10-24(11-13)17(25)12-2-1-3-14(8-12)26-16-9-20-6-7-21-16/h1-9,13H,10-11H2,(H2,19,22,23) |
| InChIKey | LCNGNWUNRDNENU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |