C20H23N3O2 — CID 126783382
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-pyrazin-2-yloxyphenyl)methanone (PubChem CID 126783382) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-pyrazin-2-yloxyphenyl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-pyrazin-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 126783382 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-pyrazin-2-yloxyphenyl)methanone |
| SMILES | O=C(c1cccc(Oc2cnccn2)c1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C20H23N3O2/c24-20(23-12-4-7-15-5-1-2-9-18(15)23)16-6-3-8-17(13-16)25-19-14-21-10-11-22-19/h3,6,8,10-11,13-15,18H,1-2,4-5,7,9,12H2/t15-,18-/m1/s1 |
| InChIKey | QACLUVOROUXUPC-CRAIPNDOSA-N |
| XLogP | 4.06 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |