C17H21Cl2N3O2 — CID 119410481
[(3R)-3-aminopyrrolidin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone;dihydrochloride (PubChem CID 119410481) has the molecular formula C17H21Cl2N3O2 and a molecular weight of 370.28 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone;dihydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119410481 |
| Molecular Formula | C17H21Cl2N3O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1CCN(C(=O)c2cccc(OCc3cccnc3)c2)C1 |
| InChI | InChI=1S/C17H19N3O2.2ClH/c18-15-6-8-20(11-15)17(21)14-4-1-5-16(9-14)22-12-13-3-2-7-19-10-13;;/h1-5,7,9-10,15H,6,8,11-12,18H2;2*1H/t15-;;/m1../s1 |
| InChIKey | BCJBYLMCJASKTC-QCUBGVIVSA-N |
| XLogP | 2.68 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |