C19H23N3O2 — CID 122149100
(4-amino-2-methylpiperidin-1-yl)-[3-(pyridin-3-ylmethoxy)phenyl]methanone (PubChem CID 122149100) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (4-amino-2-methylpiperidin-1-yl)-[3-(pyridin-3-ylmethoxy)phenyl]methanone.
| Compound Name | (4-amino-2-methylpiperidin-1-yl)-[3-(pyridin-3-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 122149100 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (4-amino-2-methylpiperidin-1-yl)-[3-(pyridin-3-ylmethoxy)phenyl]methanone |
| SMILES | CC1CC(N)CCN1C(=O)c1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-14-10-17(20)7-9-22(14)19(23)16-5-2-6-18(11-16)24-13-15-4-3-8-21-12-15/h2-6,8,11-12,14,17H,7,9-10,13,20H2,1H3 |
| InChIKey | WIBXZSIQADQUNC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |