C20H25N3O2 — CID 124692147
[(3R)-3-[(1S)-1-aminoethyl]piperidin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone (PubChem CID 124692147) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is [(3R)-3-[(1S)-1-aminoethyl]piperidin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone.
| Compound Name | [(3R)-3-[(1S)-1-aminoethyl]piperidin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 124692147 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | [(3R)-3-[(1S)-1-aminoethyl]piperidin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone |
| SMILES | C[C@H](N)[C@@H]1CCCN(C(=O)c2cccc(OCc3cccnc3)c2)C1 |
| InChI | InChI=1S/C20H25N3O2/c1-15(21)18-7-4-10-23(13-18)20(24)17-6-2-8-19(11-17)25-14-16-5-3-9-22-12-16/h2-3,5-6,8-9,11-12,15,18H,4,7,10,13-14,21H2,1H3/t15-,18+/m0/s1 |
| InChIKey | JBAITMZLJRGNIL-MAUKXSAKSA-N |
| XLogP | 2.86 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |