C22H26FN3O3S — CID 134166389
3-[3-[2-(2-fluorophenyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylphenoxy]-N-methylpropan-1-amine (PubChem CID 134166389) has the molecular formula C22H26FN3O3S and a molecular weight of 431.53 g/mol. Its IUPAC name is 3-[3-[2-(2-fluorophenyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylphenoxy]-N-methylpropan-1-amine.
| Compound Name | 3-[3-[2-(2-fluorophenyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylphenoxy]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 134166389 |
| Molecular Formula | C22H26FN3O3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 3-[3-[2-(2-fluorophenyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylphenoxy]-N-methylpropan-1-amine |
| SMILES | CNCCCOc1cccc(S(=O)(=O)n2cc(CNC)cc2-c2ccccc2F)c1 |
| InChI | InChI=1S/C22H26FN3O3S/c1-24-11-6-12-29-18-7-5-8-19(14-18)30(27,28)26-16-17(15-25-2)13-22(26)20-9-3-4-10-21(20)23/h3-5,7-10,13-14,16,24-25H,6,11-12,15H2,1-2H3 |
| InChIKey | CJXDOXQXJZQOCP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|