C21H22FNO4S — CID 175482042
2-(2-fluorophenyl)-1-[3-(3-methoxypropoxy)phenyl]sulfonyl-4-methylpyrrole (PubChem CID 175482042) has the molecular formula C21H22FNO4S and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-[3-(3-methoxypropoxy)phenyl]sulfonyl-4-methylpyrrole.
| Compound Name | 2-(2-fluorophenyl)-1-[3-(3-methoxypropoxy)phenyl]sulfonyl-4-methylpyrrole |
|---|---|
| PubChem CID | 175482042 |
| Molecular Formula | C21H22FNO4S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-(2-fluorophenyl)-1-[3-(3-methoxypropoxy)phenyl]sulfonyl-4-methylpyrrole |
| SMILES | COCCCOc1cccc(S(=O)(=O)n2cc(C)cc2-c2ccccc2F)c1 |
| InChI | InChI=1S/C21H22FNO4S/c1-16-13-21(19-9-3-4-10-20(19)22)23(15-16)28(24,25)18-8-5-7-17(14-18)27-12-6-11-26-2/h3-5,7-10,13-15H,6,11-12H2,1-2H3 |
| InChIKey | KHERRKRSPIJFOQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|