C23H23FN2O5S — CID 134166386
5-(2-fluorophenyl)-1-[3-(2-morpholin-4-ylethoxy)phenyl]sulfonylpyrrole-3-carbaldehyde (PubChem CID 134166386) has the molecular formula C23H23FN2O5S and a molecular weight of 458.51 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-1-[3-(2-morpholin-4-ylethoxy)phenyl]sulfonylpyrrole-3-carbaldehyde.
| Compound Name | 5-(2-fluorophenyl)-1-[3-(2-morpholin-4-ylethoxy)phenyl]sulfonylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 134166386 |
| Molecular Formula | C23H23FN2O5S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 5-(2-fluorophenyl)-1-[3-(2-morpholin-4-ylethoxy)phenyl]sulfonylpyrrole-3-carbaldehyde |
| SMILES | O=Cc1cc(-c2ccccc2F)n(S(=O)(=O)c2cccc(OCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C23H23FN2O5S/c24-22-7-2-1-6-21(22)23-14-18(17-27)16-26(23)32(28,29)20-5-3-4-19(15-20)31-13-10-25-8-11-30-12-9-25/h1-7,14-17H,8-13H2 |
| InChIKey | NJDZNWQOUIMGGJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|