C20H19FN2O5S — CID 166463351
5-(2-fluorophenyl)-1-[[5-(3-methoxypropoxy)-3-pyridinyl]sulfonyl]pyrrole-3-carbaldehyde (PubChem CID 166463351) has the molecular formula C20H19FN2O5S and a molecular weight of 418.45 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-1-[[5-(3-methoxypropoxy)-3-pyridinyl]sulfonyl]pyrrole-3-carbaldehyde.
| Compound Name | 5-(2-fluorophenyl)-1-[[5-(3-methoxypropoxy)-3-pyridinyl]sulfonyl]pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 166463351 |
| Molecular Formula | C20H19FN2O5S |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-(2-fluorophenyl)-1-[[5-(3-methoxypropoxy)-3-pyridinyl]sulfonyl]pyrrole-3-carbaldehyde |
| SMILES | COCCCOc1cncc(S(=O)(=O)n2cc(C=O)cc2-c2ccccc2F)c1 |
| InChI | InChI=1S/C20H19FN2O5S/c1-27-7-4-8-28-16-10-17(12-22-11-16)29(25,26)23-13-15(14-24)9-20(23)18-5-2-3-6-19(18)21/h2-3,5-6,9-14H,4,7-8H2,1H3 |
| InChIKey | PFHJWURSNLTOBZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|