C19H15FN2O3S — CID 174568427
5-(2-fluorophenyl)-1-(3-pyridin-3-ylprop-2-enylsulfonyl)pyrrole-3-carbaldehyde (PubChem CID 174568427) has the molecular formula C19H15FN2O3S and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-1-(3-pyridin-3-ylprop-2-enylsulfonyl)pyrrole-3-carbaldehyde.
| Compound Name | 5-(2-fluorophenyl)-1-(3-pyridin-3-ylprop-2-enylsulfonyl)pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 174568427 |
| Molecular Formula | C19H15FN2O3S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 5-(2-fluorophenyl)-1-(3-pyridin-3-ylprop-2-enylsulfonyl)pyrrole-3-carbaldehyde |
| SMILES | O=Cc1cc(-c2ccccc2F)n(S(=O)(=O)CC=Cc2cccnc2)c1 |
| InChI | InChI=1S/C19H15FN2O3S/c20-18-8-2-1-7-17(18)19-11-16(14-23)13-22(19)26(24,25)10-4-6-15-5-3-9-21-12-15/h1-9,11-14H,10H2 |
| InChIKey | BZYSLHCPTJVOGF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|