C26H32FN3O5S — CID 167299028
tert-butyl N-[3-[3-[2-(2-fluorophenyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylphenoxy]propyl]carbamate (PubChem CID 167299028) has the molecular formula C26H32FN3O5S and a molecular weight of 517.62 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[2-(2-fluorophenyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylphenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[2-(2-fluorophenyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylphenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 167299028 |
| Molecular Formula | C26H32FN3O5S |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | tert-butyl N-[3-[3-[2-(2-fluorophenyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylphenoxy]propyl]carbamate |
| SMILES | CNCc1cc(-c2ccccc2F)n(S(=O)(=O)c2cccc(OCCCNC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C26H32FN3O5S/c1-26(2,3)35-25(31)29-13-8-14-34-20-9-7-10-21(16-20)36(32,33)30-18-19(17-28-4)15-24(30)22-11-5-6-12-23(22)27/h5-7,9-12,15-16,18,28H,8,13-14,17H2,1-4H3,(H,29,31) |
| InChIKey | CYPWCLPVCAWDGY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|