C20H15F2NO3S — CID 178134450
4-cyclopropyl-5-(2-fluorophenyl)-1-(3-fluorophenyl)sulfonylpyrrole-3-carbaldehyde (PubChem CID 178134450) has the molecular formula C20H15F2NO3S and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-cyclopropyl-5-(2-fluorophenyl)-1-(3-fluorophenyl)sulfonylpyrrole-3-carbaldehyde.
| Compound Name | 4-cyclopropyl-5-(2-fluorophenyl)-1-(3-fluorophenyl)sulfonylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 178134450 |
| Molecular Formula | C20H15F2NO3S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 4-cyclopropyl-5-(2-fluorophenyl)-1-(3-fluorophenyl)sulfonylpyrrole-3-carbaldehyde |
| SMILES | O=Cc1cn(S(=O)(=O)c2cccc(F)c2)c(-c2ccccc2F)c1C1CC1 |
| InChI | InChI=1S/C20H15F2NO3S/c21-15-4-3-5-16(10-15)27(25,26)23-11-14(12-24)19(13-8-9-13)20(23)17-6-1-2-7-18(17)22/h1-7,10-13H,8-9H2 |
| InChIKey | YYCXDBSKQJAALP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|