C17H12F2N2O4S — CID 164883824
5-(2,4-difluorophenyl)-4-methoxy-1-pyridin-3-ylsulfonylpyrrole-3-carbaldehyde (PubChem CID 164883824) has the molecular formula C17H12F2N2O4S and a molecular weight of 378.36 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-4-methoxy-1-pyridin-3-ylsulfonylpyrrole-3-carbaldehyde.
| Compound Name | 5-(2,4-difluorophenyl)-4-methoxy-1-pyridin-3-ylsulfonylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 164883824 |
| Molecular Formula | C17H12F2N2O4S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 5-(2,4-difluorophenyl)-4-methoxy-1-pyridin-3-ylsulfonylpyrrole-3-carbaldehyde |
| SMILES | COc1c(C=O)cn(S(=O)(=O)c2cccnc2)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C17H12F2N2O4S/c1-25-17-11(10-22)9-21(26(23,24)13-3-2-6-20-8-13)16(17)14-5-4-12(18)7-15(14)19/h2-10H,1H3 |
| InChIKey | RZPUHQLRFPSKEO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|