C17H17F2NO4 — CID 162519687
tert-butyl 2-(2,4-difluorophenyl)-4-formyl-3-methoxypyrrole-1-carboxylate (PubChem CID 162519687) has the molecular formula C17H17F2NO4 and a molecular weight of 337.32 g/mol. Its IUPAC name is tert-butyl 2-(2,4-difluorophenyl)-4-formyl-3-methoxypyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-(2,4-difluorophenyl)-4-formyl-3-methoxypyrrole-1-carboxylate |
|---|---|
| PubChem CID | 162519687 |
| Molecular Formula | C17H17F2NO4 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | tert-butyl 2-(2,4-difluorophenyl)-4-formyl-3-methoxypyrrole-1-carboxylate |
| SMILES | COc1c(C=O)cn(C(=O)OC(C)(C)C)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C17H17F2NO4/c1-17(2,3)24-16(22)20-8-10(9-21)15(23-4)14(20)12-6-5-11(18)7-13(12)19/h5-9H,1-4H3 |
| InChIKey | UEKUJEAHKDOACM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|