C18H11F4NO4S — CID 135353595
1-(3-fluorophenyl)sulfonyl-4-methoxy-5-(2,4,6-trifluorophenyl)pyrrole-3-carbaldehyde (PubChem CID 135353595) has the molecular formula C18H11F4NO4S and a molecular weight of 413.35 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-4-methoxy-5-(2,4,6-trifluorophenyl)pyrrole-3-carbaldehyde.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-4-methoxy-5-(2,4,6-trifluorophenyl)pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 135353595 |
| Molecular Formula | C18H11F4NO4S |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-4-methoxy-5-(2,4,6-trifluorophenyl)pyrrole-3-carbaldehyde |
| SMILES | COc1c(C=O)cn(S(=O)(=O)c2cccc(F)c2)c1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C18H11F4NO4S/c1-27-18-10(9-24)8-23(28(25,26)13-4-2-3-11(19)5-13)17(18)16-14(21)6-12(20)7-15(16)22/h2-9H,1H3 |
| InChIKey | APDICUAPBUUDMH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|