C12H9F2NO2 — CID 162519676
5-(2,4-difluorophenyl)-4-methoxy-1H-pyrrole-3-carbaldehyde (PubChem CID 162519676) has the molecular formula C12H9F2NO2 and a molecular weight of 237.21 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-4-methoxy-1H-pyrrole-3-carbaldehyde.
| Compound Name | 5-(2,4-difluorophenyl)-4-methoxy-1H-pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 162519676 |
| Molecular Formula | C12H9F2NO2 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-(2,4-difluorophenyl)-4-methoxy-1H-pyrrole-3-carbaldehyde |
| SMILES | COc1c(C=O)c[nH]c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C12H9F2NO2/c1-17-12-7(6-16)5-15-11(12)9-3-2-8(13)4-10(9)14/h2-6,15H,1H3 |
| InChIKey | PASGVETWJJIACY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|