C15H15N5O3 — CID 18975311
tert-butyl 3-formyl-5-(1,2,4-triazol-4-yl)pyrrolo[2,3-c]pyridine-1-carboxylate (PubChem CID 18975311) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is tert-butyl 3-formyl-5-(1,2,4-triazol-4-yl)pyrrolo[2,3-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-formyl-5-(1,2,4-triazol-4-yl)pyrrolo[2,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 18975311 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | tert-butyl 3-formyl-5-(1,2,4-triazol-4-yl)pyrrolo[2,3-c]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C=O)c2cc(-n3cnnc3)ncc21 |
| InChI | InChI=1S/C15H15N5O3/c1-15(2,3)23-14(22)20-6-10(7-21)11-4-13(16-5-12(11)20)19-8-17-18-9-19/h4-9H,1-3H3 |
| InChIKey | NXWFDFVBDYGSGR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|