C20H21NO6 — CID 56969706
tert-butyl 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]indole-1-carboxylate (PubChem CID 56969706) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is tert-butyl 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 56969706 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | tert-butyl 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C=C2C(=O)OC(C)(C)OC2=O)c2ccccc21 |
| InChI | InChI=1S/C20H21NO6/c1-19(2,3)27-18(24)21-11-12(13-8-6-7-9-15(13)21)10-14-16(22)25-20(4,5)26-17(14)23/h6-11H,1-5H3 |
| InChIKey | NEZZTRQCAIDOMX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|