C19H16FNO3S — CID 177315196
[1-(3-fluorophenyl)sulfonyl-4,5-dihydrobenzo[g]indol-3-yl]methanol (PubChem CID 177315196) has the molecular formula C19H16FNO3S and a molecular weight of 357.41 g/mol. Its IUPAC name is [1-(3-fluorophenyl)sulfonyl-4,5-dihydrobenzo[g]indol-3-yl]methanol.
| Compound Name | [1-(3-fluorophenyl)sulfonyl-4,5-dihydrobenzo[g]indol-3-yl]methanol |
|---|---|
| PubChem CID | 177315196 |
| Molecular Formula | C19H16FNO3S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [1-(3-fluorophenyl)sulfonyl-4,5-dihydrobenzo[g]indol-3-yl]methanol |
| SMILES | O=S(=O)(c1cccc(F)c1)n1cc(CO)c2c1-c1ccccc1CC2 |
| InChI | InChI=1S/C19H16FNO3S/c20-15-5-3-6-16(10-15)25(23,24)21-11-14(12-22)18-9-8-13-4-1-2-7-17(13)19(18)21/h1-7,10-11,22H,8-9,12H2 |
| InChIKey | KYIPDHFOGLTUAK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |