C23H27ClN2O3S — CID 177315055
1-[3-(3-methoxyphenyl)sulfonyl-3-azatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,11,13-pentaen-5-yl]-N-methylmethanamine;hydrochloride (PubChem CID 177315055) has the molecular formula C23H27ClN2O3S and a molecular weight of 447.00 g/mol. Its IUPAC name is 1-[3-(3-methoxyphenyl)sulfonyl-3-azatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,11,13-pentaen-5-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[3-(3-methoxyphenyl)sulfonyl-3-azatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,11,13-pentaen-5-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 177315055 |
| Molecular Formula | C23H27ClN2O3S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-[3-(3-methoxyphenyl)sulfonyl-3-azatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,11,13-pentaen-5-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCc1cn(S(=O)(=O)c2cccc(OC)c2)c2c1CCCCc1ccccc1-2.Cl |
| InChI | InChI=1S/C23H26N2O3S.ClH/c1-24-15-18-16-25(29(26,27)20-11-7-10-19(14-20)28-2)23-21-12-5-3-8-17(21)9-4-6-13-22(18)23;/h3,5,7-8,10-12,14,16,24H,4,6,9,13,15H2,1-2H3;1H |
| InChIKey | VKKRCFYNZXPCAR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |