C21H23N3O2S — CID 177315116
N-[(3-pyridin-3-ylsulfonyl-3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)methyl]ethanamine (PubChem CID 177315116) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[(3-pyridin-3-ylsulfonyl-3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)methyl]ethanamine.
| Compound Name | N-[(3-pyridin-3-ylsulfonyl-3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 177315116 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[(3-pyridin-3-ylsulfonyl-3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)methyl]ethanamine |
| SMILES | CCNCc1cn(S(=O)(=O)c2cccnc2)c2c1CCCc1ccccc1-2 |
| InChI | InChI=1S/C21H23N3O2S/c1-2-22-13-17-15-24(27(25,26)18-9-6-12-23-14-18)21-19-10-4-3-7-16(19)8-5-11-20(17)21/h3-4,6-7,9-10,12,14-15,22H,2,5,8,11,13H2,1H3 |
| InChIKey | RAJUJIDULSNHKS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |