C15H17ClN4O2S — CID 142724812
3-(methylaminomethyl)-1-pyridin-3-ylsulfonylindol-6-amine;hydrochloride (PubChem CID 142724812) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is 3-(methylaminomethyl)-1-pyridin-3-ylsulfonylindol-6-amine;hydrochloride.
| Compound Name | 3-(methylaminomethyl)-1-pyridin-3-ylsulfonylindol-6-amine;hydrochloride |
|---|---|
| PubChem CID | 142724812 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-(methylaminomethyl)-1-pyridin-3-ylsulfonylindol-6-amine;hydrochloride |
| SMILES | CNCc1cn(S(=O)(=O)c2cccnc2)c2cc(N)ccc12.Cl |
| InChI | InChI=1S/C15H16N4O2S.ClH/c1-17-8-11-10-19(15-7-12(16)4-5-14(11)15)22(20,21)13-3-2-6-18-9-13;/h2-7,9-10,17H,8,16H2,1H3;1H |
| InChIKey | DFWCQRXZWFYFAT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|