C17H17N3O5S — CID 134346738
[6-(hydroxymethyl)-1-pyridin-3-ylsulfonylindol-3-yl]methyl N-methylcarbamate (PubChem CID 134346738) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is [6-(hydroxymethyl)-1-pyridin-3-ylsulfonylindol-3-yl]methyl N-methylcarbamate.
| Compound Name | [6-(hydroxymethyl)-1-pyridin-3-ylsulfonylindol-3-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 134346738 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [6-(hydroxymethyl)-1-pyridin-3-ylsulfonylindol-3-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1cn(S(=O)(=O)c2cccnc2)c2cc(CO)ccc12 |
| InChI | InChI=1S/C17H17N3O5S/c1-18-17(22)25-11-13-9-20(16-7-12(10-21)4-5-15(13)16)26(23,24)14-3-2-6-19-8-14/h2-9,21H,10-11H2,1H3,(H,18,22) |
| InChIKey | ZPXDNUILXPNYKR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |