C17H16BrN3O4S — CID 175317176
2-[6-(bromomethyl)-1-pyridin-3-ylsulfonylindol-3-yl]ethyl carbamate (PubChem CID 175317176) has the molecular formula C17H16BrN3O4S and a molecular weight of 438.30 g/mol. Its IUPAC name is 2-[6-(bromomethyl)-1-pyridin-3-ylsulfonylindol-3-yl]ethyl carbamate.
| Compound Name | 2-[6-(bromomethyl)-1-pyridin-3-ylsulfonylindol-3-yl]ethyl carbamate |
|---|---|
| PubChem CID | 175317176 |
| Molecular Formula | C17H16BrN3O4S |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 2-[6-(bromomethyl)-1-pyridin-3-ylsulfonylindol-3-yl]ethyl carbamate |
| SMILES | NC(=O)OCCc1cn(S(=O)(=O)c2cccnc2)c2cc(CBr)ccc12 |
| InChI | InChI=1S/C17H16BrN3O4S/c18-9-12-3-4-15-13(5-7-25-17(19)22)11-21(16(15)8-12)26(23,24)14-2-1-6-20-10-14/h1-4,6,8,10-11H,5,7,9H2,(H2,19,22) |
| InChIKey | KATHSJXVZKKHOO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|