C23H24N4O3S — CID 174792289
N-[(4-methoxyphenyl)methyl]-3-(methylaminomethyl)-1-pyridin-3-ylsulfonylindol-6-amine (PubChem CID 174792289) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-3-(methylaminomethyl)-1-pyridin-3-ylsulfonylindol-6-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-3-(methylaminomethyl)-1-pyridin-3-ylsulfonylindol-6-amine |
|---|---|
| PubChem CID | 174792289 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-3-(methylaminomethyl)-1-pyridin-3-ylsulfonylindol-6-amine |
| SMILES | CNCc1cn(S(=O)(=O)c2cccnc2)c2cc(NCc3ccc(OC)cc3)ccc12 |
| InChI | InChI=1S/C23H24N4O3S/c1-24-14-18-16-27(31(28,29)21-4-3-11-25-15-21)23-12-19(7-10-22(18)23)26-13-17-5-8-20(30-2)9-6-17/h3-12,15-16,24,26H,13-14H2,1-2H3 |
| InChIKey | MIVAIACBYDPPJW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |