C15H13BrN2O2S — CID 174792264
6-(bromomethyl)-3-methyl-1-pyridin-3-ylsulfonylindole (PubChem CID 174792264) has the molecular formula C15H13BrN2O2S and a molecular weight of 365.25 g/mol. Its IUPAC name is 6-(bromomethyl)-3-methyl-1-pyridin-3-ylsulfonylindole.
| Compound Name | 6-(bromomethyl)-3-methyl-1-pyridin-3-ylsulfonylindole |
|---|---|
| PubChem CID | 174792264 |
| Molecular Formula | C15H13BrN2O2S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 6-(bromomethyl)-3-methyl-1-pyridin-3-ylsulfonylindole |
| SMILES | Cc1cn(S(=O)(=O)c2cccnc2)c2cc(CBr)ccc12 |
| InChI | InChI=1S/C15H13BrN2O2S/c1-11-10-18(15-7-12(8-16)4-5-14(11)15)21(19,20)13-3-2-6-17-9-13/h2-7,9-10H,8H2,1H3 |
| InChIKey | AUJKGCCINZAYOC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|