C21H16F2N2O2S — CID 141441934
6-[(2,3-difluoro-4-methylphenyl)methyl]-1-pyridin-3-ylsulfonylindole (PubChem CID 141441934) has the molecular formula C21H16F2N2O2S and a molecular weight of 398.43 g/mol. Its IUPAC name is 6-[(2,3-difluoro-4-methylphenyl)methyl]-1-pyridin-3-ylsulfonylindole.
| Compound Name | 6-[(2,3-difluoro-4-methylphenyl)methyl]-1-pyridin-3-ylsulfonylindole |
|---|---|
| PubChem CID | 141441934 |
| Molecular Formula | C21H16F2N2O2S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 6-[(2,3-difluoro-4-methylphenyl)methyl]-1-pyridin-3-ylsulfonylindole |
| SMILES | Cc1ccc(Cc2ccc3ccn(S(=O)(=O)c4cccnc4)c3c2)c(F)c1F |
| InChI | InChI=1S/C21H16F2N2O2S/c1-14-4-6-17(21(23)20(14)22)11-15-5-7-16-8-10-25(19(16)12-15)28(26,27)18-3-2-9-24-13-18/h2-10,12-13H,11H2,1H3 |
| InChIKey | XWLMLMLKTRVOLK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |