C23H20ClNO3S — CID 141441909
6-[(2-chloro-4-methylphenyl)methyl]-1-(3-methoxyphenyl)sulfonylindole (PubChem CID 141441909) has the molecular formula C23H20ClNO3S and a molecular weight of 425.94 g/mol. Its IUPAC name is 6-[(2-chloro-4-methylphenyl)methyl]-1-(3-methoxyphenyl)sulfonylindole.
| Compound Name | 6-[(2-chloro-4-methylphenyl)methyl]-1-(3-methoxyphenyl)sulfonylindole |
|---|---|
| PubChem CID | 141441909 |
| Molecular Formula | C23H20ClNO3S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 6-[(2-chloro-4-methylphenyl)methyl]-1-(3-methoxyphenyl)sulfonylindole |
| SMILES | COc1cccc(S(=O)(=O)n2ccc3ccc(Cc4ccc(C)cc4Cl)cc32)c1 |
| InChI | InChI=1S/C23H20ClNO3S/c1-16-6-8-19(22(24)12-16)13-17-7-9-18-10-11-25(23(18)14-17)29(26,27)21-5-3-4-20(15-21)28-2/h3-12,14-15H,13H2,1-2H3 |
| InChIKey | YCZZWAZFXNHMOO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |