C24H29N3O5S — CID 53084939
1-[1-(3-methoxyphenyl)sulfonylpiperidin-4-yl]-4-[(4-methylphenyl)methyl]piperazine-2,3-dione (PubChem CID 53084939) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 1-[1-(3-methoxyphenyl)sulfonylpiperidin-4-yl]-4-[(4-methylphenyl)methyl]piperazine-2,3-dione.
| Compound Name | 1-[1-(3-methoxyphenyl)sulfonylpiperidin-4-yl]-4-[(4-methylphenyl)methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 53084939 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-[1-(3-methoxyphenyl)sulfonylpiperidin-4-yl]-4-[(4-methylphenyl)methyl]piperazine-2,3-dione |
| SMILES | COc1cccc(S(=O)(=O)N2CCC(N3CCN(Cc4ccc(C)cc4)C(=O)C3=O)CC2)c1 |
| InChI | InChI=1S/C24H29N3O5S/c1-18-6-8-19(9-7-18)17-25-14-15-27(24(29)23(25)28)20-10-12-26(13-11-20)33(30,31)22-5-3-4-21(16-22)32-2/h3-9,16,20H,10-15,17H2,1-2H3 |
| InChIKey | FJKGXLCIDQLQCT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|