C19H27N3O5S — CID 20955369
1-(2-methoxyethyl)-4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]piperazine-2,3-dione (PubChem CID 20955369) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]piperazine-2,3-dione.
| Compound Name | 1-(2-methoxyethyl)-4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 20955369 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-(2-methoxyethyl)-4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]piperazine-2,3-dione |
| SMILES | COCCN1CCN(C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)C(=O)C1=O |
| InChI | InChI=1S/C19H27N3O5S/c1-15-3-5-17(6-4-15)28(25,26)21-9-7-16(8-10-21)22-12-11-20(13-14-27-2)18(23)19(22)24/h3-6,16H,7-14H2,1-2H3 |
| InChIKey | HEDFLFQKYBVSOZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|