C22H31N3O4S — CID 53053385
1-[1-[4-(2-methylpropyl)phenyl]sulfonylpiperidin-4-yl]-4-prop-2-enylpiperazine-2,3-dione (PubChem CID 53053385) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is 1-[1-[4-(2-methylpropyl)phenyl]sulfonylpiperidin-4-yl]-4-prop-2-enylpiperazine-2,3-dione.
| Compound Name | 1-[1-[4-(2-methylpropyl)phenyl]sulfonylpiperidin-4-yl]-4-prop-2-enylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 53053385 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 1-[1-[4-(2-methylpropyl)phenyl]sulfonylpiperidin-4-yl]-4-prop-2-enylpiperazine-2,3-dione |
| SMILES | C=CCN1CCN(C2CCN(S(=O)(=O)c3ccc(CC(C)C)cc3)CC2)C(=O)C1=O |
| InChI | InChI=1S/C22H31N3O4S/c1-4-11-23-14-15-25(22(27)21(23)26)19-9-12-24(13-10-19)30(28,29)20-7-5-18(6-8-20)16-17(2)3/h4-8,17,19H,1,9-16H2,2-3H3 |
| InChIKey | HANJTTARMGIMFF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|