C25H30FN3O4S — CID 53004248
1-[(3-fluorophenyl)methyl]-4-[1-(4-propylphenyl)sulfonylpiperidin-4-yl]piperazine-2,3-dione (PubChem CID 53004248) has the molecular formula C25H30FN3O4S and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-4-[1-(4-propylphenyl)sulfonylpiperidin-4-yl]piperazine-2,3-dione.
| Compound Name | 1-[(3-fluorophenyl)methyl]-4-[1-(4-propylphenyl)sulfonylpiperidin-4-yl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 53004248 |
| Molecular Formula | C25H30FN3O4S |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-4-[1-(4-propylphenyl)sulfonylpiperidin-4-yl]piperazine-2,3-dione |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCC(N3CCN(Cc4cccc(F)c4)C(=O)C3=O)CC2)cc1 |
| InChI | InChI=1S/C25H30FN3O4S/c1-2-4-19-7-9-23(10-8-19)34(32,33)28-13-11-22(12-14-28)29-16-15-27(24(30)25(29)31)18-20-5-3-6-21(26)17-20/h3,5-10,17,22H,2,4,11-16,18H2,1H3 |
| InChIKey | HTSLQFCFKLAQJN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|