C24H32FN3O3 — CID 53004232
1-[1-(2-cyclohexylacetyl)piperidin-4-yl]-4-[(3-fluorophenyl)methyl]piperazine-2,3-dione (PubChem CID 53004232) has the molecular formula C24H32FN3O3 and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-[1-(2-cyclohexylacetyl)piperidin-4-yl]-4-[(3-fluorophenyl)methyl]piperazine-2,3-dione.
| Compound Name | 1-[1-(2-cyclohexylacetyl)piperidin-4-yl]-4-[(3-fluorophenyl)methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 53004232 |
| Molecular Formula | C24H32FN3O3 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-[1-(2-cyclohexylacetyl)piperidin-4-yl]-4-[(3-fluorophenyl)methyl]piperazine-2,3-dione |
| SMILES | O=C(CC1CCCCC1)N1CCC(N2CCN(Cc3cccc(F)c3)C(=O)C2=O)CC1 |
| InChI | InChI=1S/C24H32FN3O3/c25-20-8-4-7-19(15-20)17-27-13-14-28(24(31)23(27)30)21-9-11-26(12-10-21)22(29)16-18-5-2-1-3-6-18/h4,7-8,15,18,21H,1-3,5-6,9-14,16-17H2 |
| InChIKey | IZQKIIZUMICCIW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|