C20H22FN3O3 — CID 50789358
1-[(3-fluorophenyl)methyl]-3-[1-(furan-2-carbonyl)piperidin-4-yl]imidazolidin-2-one (PubChem CID 50789358) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-[1-(furan-2-carbonyl)piperidin-4-yl]imidazolidin-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-[1-(furan-2-carbonyl)piperidin-4-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 50789358 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-[1-(furan-2-carbonyl)piperidin-4-yl]imidazolidin-2-one |
| SMILES | O=C(c1ccco1)N1CCC(N2CCN(Cc3cccc(F)c3)C2=O)CC1 |
| InChI | InChI=1S/C20H22FN3O3/c21-16-4-1-3-15(13-16)14-23-10-11-24(20(23)26)17-6-8-22(9-7-17)19(25)18-5-2-12-27-18/h1-5,12-13,17H,6-11,14H2 |
| InChIKey | WIMNMCKPEHGNOR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |