C21H28FN3O4 — CID 46344020
tert-butyl 4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxylate (PubChem CID 46344020) has the molecular formula C21H28FN3O4 and a molecular weight of 405.47 g/mol. Its IUPAC name is tert-butyl 4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46344020 |
| Molecular Formula | C21H28FN3O4 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl 4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCN(Cc3ccc(F)cc3)C(=O)C2=O)CC1 |
| InChI | InChI=1S/C21H28FN3O4/c1-21(2,3)29-20(28)23-10-8-17(9-11-23)25-13-12-24(18(26)19(25)27)14-15-4-6-16(22)7-5-15/h4-7,17H,8-14H2,1-3H3 |
| InChIKey | RDTQGAJSNGCWPM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|