C25H29FN4O3 — CID 53029113
N-(2,3-dimethylphenyl)-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide (PubChem CID 53029113) has the molecular formula C25H29FN4O3 and a molecular weight of 452.53 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 53029113 |
| Molecular Formula | C25H29FN4O3 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCC(N3CCN(Cc4ccc(F)cc4)C(=O)C3=O)CC2)c1C |
| InChI | InChI=1S/C25H29FN4O3/c1-17-4-3-5-22(18(17)2)27-25(33)28-12-10-21(11-13-28)30-15-14-29(23(31)24(30)32)16-19-6-8-20(26)9-7-19/h3-9,21H,10-16H2,1-2H3,(H,27,33) |
| InChIKey | AZDNXFBKQHXYAW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|