C24H27ClN4O3 — CID 53030710
4-(4-benzyl-2,3-dioxopiperazin-1-yl)-N-(5-chloro-2-methylphenyl)piperidine-1-carboxamide (PubChem CID 53030710) has the molecular formula C24H27ClN4O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is 4-(4-benzyl-2,3-dioxopiperazin-1-yl)-N-(5-chloro-2-methylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-(4-benzyl-2,3-dioxopiperazin-1-yl)-N-(5-chloro-2-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 53030710 |
| Molecular Formula | C24H27ClN4O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-(4-benzyl-2,3-dioxopiperazin-1-yl)-N-(5-chloro-2-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)N1CCC(N2CCN(Cc3ccccc3)C(=O)C2=O)CC1 |
| InChI | InChI=1S/C24H27ClN4O3/c1-17-7-8-19(25)15-21(17)26-24(32)27-11-9-20(10-12-27)29-14-13-28(22(30)23(29)31)16-18-5-3-2-4-6-18/h2-8,15,20H,9-14,16H2,1H3,(H,26,32) |
| InChIKey | SZVHEUFSUISPMG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|